C9H18Cl3N — CID 57362051
1,2-bis(2-chloroethyl)piperidine;hydrochloride (PubChem CID 57362051) has the molecular formula C9H18Cl3N and a molecular weight of 246.61 g/mol. Its IUPAC name is 1,2-bis(2-chloroethyl)piperidine;hydrochloride.
| Compound Name | 1,2-bis(2-chloroethyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 57362051 |
| Molecular Formula | C9H18Cl3N |
| Molecular Weight | 246.61 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 1,2-bis(2-chloroethyl)piperidine;hydrochloride |
| SMILES | Cl.ClCCC1CCCCN1CCCl |
| InChI | InChI=1S/C9H17Cl2N.ClH/c10-5-4-9-3-1-2-7-12(9)8-6-11;/h9H,1-8H2;1H |
| InChIKey | KOWUDRSVPXDCRU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|