About N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine
N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine (PubChem CID 57362090) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine |
| PubChem CID | 57362090 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine |
| SMILES | Cc1onc(C=CN(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N3O3/c1-6-8(11(12)13)7(9-14-6)4-5-10(2)3/h4-5H,1-3H3 |
| InChIKey | MSUVJIWBYIEEMR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine?
The IUPAC name of N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine (CID 57362090) is N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine.
What is the SMILES notation for N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine?
The canonical SMILES for N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine is Cc1onc(C=CN(C)C)c1[N+](=O)[O-].
What is the InChIKey of N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine?
The InChIKey is MSUVJIWBYIEEMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-6-8(11(12)13)7(9-14-6)4-5-10(2)3/h4-5H,1-3H3.
What are the key properties of N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine?
N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine has a molecular weight of 197.19 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(5-methyl-4-nitro-1,2-oxazol-3-yl)ethenamine is sourced from PubChem (CID 57362090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).