3-(2,5-dioxopyrrol-1-yl)propanoic acid

C7H7NO4 — CID 573621

IUPAC3-(2,5-dioxopyrrol-1-yl)propanoic acid
SMILESO=C(O)CCN1C(=O)C=CC1=O
InChIInChI=1S/C7H7NO4/c9-5-1-2-6(10)8(5)4-3-7(11)12/h1-2H,3-4H2,(H,11,12)
InChIKeyIUTPJBLLJJNPAJ-UHFFFAOYSA-N
MW169.14 g/mol
LogP-0.61
Rot. Bonds3

About 3-(2,5-dioxopyrrol-1-yl)propanoic acid

3-(2,5-dioxopyrrol-1-yl)propanoic acid (PubChem CID 573621) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)propanoic acid.

Molecular Properties

Compound Name3-(2,5-dioxopyrrol-1-yl)propanoic acid
PubChem CID573621
Molecular FormulaC7H7NO4
Molecular Weight169.14 g/mol
Exact Mass169.04
IUPAC Name3-(2,5-dioxopyrrol-1-yl)propanoic acid
SMILESO=C(O)CCN1C(=O)C=CC1=O
InChIInChI=1S/C7H7NO4/c9-5-1-2-6(10)8(5)4-3-7(11)12/h1-2H,3-4H2,(H,11,12)
InChIKeyIUTPJBLLJJNPAJ-UHFFFAOYSA-N
XLogP-0.61
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.14
LogP ≤ 5-0.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 3-(2,5-dioxopyrrol-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)propanoic acid?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)propanoic acid (CID 573621) is 3-(2,5-dioxopyrrol-1-yl)propanoic acid.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)propanoic acid?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)propanoic acid is O=C(O)CCN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)propanoic acid?
The InChIKey is IUTPJBLLJJNPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4/c9-5-1-2-6(10)8(5)4-3-7(11)12/h1-2H,3-4H2,(H,11,12).
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)propanoic acid?
3-(2,5-dioxopyrrol-1-yl)propanoic acid has a molecular weight of 169.14 g/mol, XLogP of -0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)propanoic acid is sourced from PubChem (CID 573621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).