C19H31N3O2 — CID 57362257
tert-butyl N-methyl-N-[(1S)-2-(4-methylpiperazin-1-yl)-1-phenylethyl]carbamate (PubChem CID 57362257) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(1S)-2-(4-methylpiperazin-1-yl)-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(1S)-2-(4-methylpiperazin-1-yl)-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 57362257 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | tert-butyl N-methyl-N-[(1S)-2-(4-methylpiperazin-1-yl)-1-phenylethyl]carbamate |
| SMILES | CN1CCN(C[C@H](c2ccccc2)N(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H31N3O2/c1-19(2,3)24-18(23)21(5)17(16-9-7-6-8-10-16)15-22-13-11-20(4)12-14-22/h6-10,17H,11-15H2,1-5H3/t17-/m1/s1 |
| InChIKey | CJRCMJOZAFMBES-QGZVFWFLSA-N |
| XLogP | 2.84 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |