C15H18N2O8 — CID 57362522
dimethyl (2R)-2-[(4-nitrophenyl)methoxycarbonylamino]pentanedioate (PubChem CID 57362522) has the molecular formula C15H18N2O8 and a molecular weight of 354.32 g/mol. Its IUPAC name is dimethyl (2R)-2-[(4-nitrophenyl)methoxycarbonylamino]pentanedioate.
| Compound Name | dimethyl (2R)-2-[(4-nitrophenyl)methoxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 57362522 |
| Molecular Formula | C15H18N2O8 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | dimethyl (2R)-2-[(4-nitrophenyl)methoxycarbonylamino]pentanedioate |
| SMILES | COC(=O)CC[C@@H](NC(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)OC |
| InChI | InChI=1S/C15H18N2O8/c1-23-13(18)8-7-12(14(19)24-2)16-15(20)25-9-10-3-5-11(6-4-10)17(21)22/h3-6,12H,7-9H2,1-2H3,(H,16,20)/t12-/m1/s1 |
| InChIKey | KVHPMEYHXTZDPZ-GFCCVEGCSA-N |
| XLogP | 1.32 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|