About CID 57362880
CID 57362880 (PubChem CID 57362880) has the molecular formula C19H23FeNO6
and a molecular weight of 417.24 g/mol.
Molecular Properties
| Compound Name | CID 57362880 |
| PubChem CID | 57362880 |
| Molecular Formula | C19H23FeNO6 |
| Molecular Weight | 417.24 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | — |
| SMILES | COC1=CC(c2c(N)c(OC)c(C)c(OC)c2OC(C)=O)CC=C1.[C]=O.[Fe] |
| InChI | InChI=1S/C18H23NO5.CO.Fe/c1-10-16(22-4)15(19)14(12-7-6-8-13(9-12)21-3)18(17(10)23-5)24-11(2)20;1-2;/h6,8-9,12H,7,19H2,1-5H3;; |
| InChIKey | DEAMECXPPDORHX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 57362880 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57362880?
The IUPAC name of CID 57362880 (CID 57362880) is not available.
What is the SMILES notation for CID 57362880?
The canonical SMILES for CID 57362880 is COC1=CC(c2c(N)c(OC)c(C)c(OC)c2OC(C)=O)CC=C1.[C]=O.[Fe].
What is the InChIKey of CID 57362880?
The InChIKey is DEAMECXPPDORHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO5.CO.Fe/c1-10-16(22-4)15(19)14(12-7-6-8-13(9-12)21-3)18(17(10)23-5)24-11(2)20;1-2;/h6,8-9,12H,7,19H2,1-5H3;;.
What are the key properties of CID 57362880?
CID 57362880 has a molecular weight of 417.24 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57362880 is sourced from PubChem (CID 57362880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).