C28H35N2O9S- — CID 57363472
N-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(3-oxobutyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 57363472) has the molecular formula C28H35N2O9S- and a molecular weight of 575.66 g/mol. Its IUPAC name is N-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(3-oxobutyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | N-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(3-oxobutyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 57363472 |
| Molecular Formula | C28H35N2O9S- |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | N-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(3-oxobutyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CCC(C)=O)C[C@@H](O)[C@H](Cc2ccccc2)N(C(=O)[O-])[C@H]2CO[C@H]3OCC[C@H]32)cc1 |
| InChI | InChI=1S/C28H36N2O9S/c1-19(31)12-14-29(40(35,36)22-10-8-21(37-2)9-11-22)17-26(32)24(16-20-6-4-3-5-7-20)30(28(33)34)25-18-39-27-23(25)13-15-38-27/h3-11,23-27,32H,12-18H2,1-2H3,(H,33,34)/p-1/t23-,24-,25-,26+,27+/m0/s1 |
| InChIKey | AUDMLZWKQNZAEQ-AFTJIJFZSA-M |
| XLogP | 1.04 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |