About tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid
tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid (PubChem CID 57363936) has the molecular formula C15H23NO3S
and a molecular weight of 297.42 g/mol. Its IUPAC name is tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid |
| PubChem CID | 57363936 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid |
| SMILES | CSC[C@@H](O)[C@H](c1ccccc1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H23NO3S/c1-15(2,3)16(14(18)19)13(12(17)10-20-4)11-8-6-5-7-9-11/h5-9,12-13,17H,10H2,1-4H3,(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | ARMSDTRHSOKLOO-OLZOCXBDSA-N |
| XLogP | 3.23 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid?
The IUPAC name of tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid (CID 57363936) is tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid.
What is the SMILES notation for tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid?
The canonical SMILES for tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid is CSC[C@@H](O)[C@H](c1ccccc1)N(C(=O)O)C(C)(C)C.
What is the InChIKey of tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid?
The InChIKey is ARMSDTRHSOKLOO-OLZOCXBDSA-N. The full InChI is InChI=1S/C15H23NO3S/c1-15(2,3)16(14(18)19)13(12(17)10-20-4)11-8-6-5-7-9-11/h5-9,12-13,17H,10H2,1-4H3,(H,18,19)/t12-,13+/m1/s1.
What are the key properties of tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid?
tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid has a molecular weight of 297.42 g/mol, XLogP of 3.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S,2S)-2-hydroxy-3-methylsulfanyl-1-phenylpropyl]carbamic acid is sourced from PubChem (CID 57363936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).