C10F18O — CID 57364009
1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxy)pent-1-ene (PubChem CID 57364009) has the molecular formula C10F18O and a molecular weight of 478.07 g/mol. Its IUPAC name is 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxy)pent-1-ene.
| Compound Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxy)pent-1-ene |
|---|---|
| PubChem CID | 57364009 |
| Molecular Formula | C10F18O |
| Molecular Weight | 478.07 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | 1,2,3,3,4,4,5,5,5-nonafluoro-1-(1,2,3,3,4,4,5,5,5-nonafluoropent-1-enoxy)pent-1-ene |
| SMILES | FC(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)F)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F18O/c11-1(5(15,16)7(19,20)9(23,24)25)3(13)29-4(14)2(12)6(17,18)8(21,22)10(26,27)28 |
| InChIKey | BZPCMSSQHRAJCC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.07 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|