About 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine
2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine (PubChem CID 57364385) has the molecular formula C24H21Cl2N5
and a molecular weight of 450.37 g/mol. Its IUPAC name is 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine.
Molecular Properties
| Compound Name | 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine |
| PubChem CID | 57364385 |
| Molecular Formula | C24H21Cl2N5 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine |
| SMILES | CC1(c2ccc(Cl)cc2)C=C(c2ccc(Cl)cc2)C(C#N)=C(C(C#N)C#N)N1.CCN |
| InChI | InChI=1S/C22H14Cl2N4.C2H7N/c1-22(16-4-8-18(24)9-5-16)10-19(14-2-6-17(23)7-3-14)20(13-27)21(28-22)15(11-25)12-26;1-2-3/h2-10,15,28H,1H3;2-3H2,1H3 |
| InChIKey | VNKHTQYSJFATDH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine?
The IUPAC name of 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine (CID 57364385) is 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine.
What is the SMILES notation for 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine?
The canonical SMILES for 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine is CC1(c2ccc(Cl)cc2)C=C(c2ccc(Cl)cc2)C(C#N)=C(C(C#N)C#N)N1.CCN.
What is the InChIKey of 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine?
The InChIKey is VNKHTQYSJFATDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14Cl2N4.C2H7N/c1-22(16-4-8-18(24)9-5-16)10-19(14-2-6-17(23)7-3-14)20(13-27)21(28-22)15(11-25)12-26;1-2-3/h2-10,15,28H,1H3;2-3H2,1H3.
What are the key properties of 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine?
2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine has a molecular weight of 450.37 g/mol, XLogP of 5.30, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,6-bis(4-chlorophenyl)-3-cyano-6-methyl-1H-pyridin-2-yl]propanedinitrile;ethanamine is sourced from PubChem (CID 57364385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).