C29H37N3O9S — CID 57364578
[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-(1,3-dioxan-5-yl)carbamic acid (PubChem CID 57364578) has the molecular formula C29H37N3O9S and a molecular weight of 603.69 g/mol. Its IUPAC name is [(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-(1,3-dioxan-5-yl)carbamic acid.
| Compound Name | [(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-(1,3-dioxan-5-yl)carbamic acid |
|---|---|
| PubChem CID | 57364578 |
| Molecular Formula | C29H37N3O9S |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | [(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-(4-cyano-2,2-dimethylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-(1,3-dioxan-5-yl)carbamic acid |
| SMILES | CC(C)(CCC#N)CN(C[C@@H](O)[C@H](Cc1ccccc1)N(C(=O)O)C1COCOC1)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H37N3O9S/c1-29(2,11-6-12-30)18-31(42(36,37)23-9-10-26-27(14-23)41-20-40-26)15-25(33)24(13-21-7-4-3-5-8-21)32(28(34)35)22-16-38-19-39-17-22/h3-5,7-10,14,22,24-25,33H,6,11,13,15-20H2,1-2H3,(H,34,35)/t24-,25+/m0/s1 |
| InChIKey | DTSNFPDYZYCTRQ-LOSJGSFVSA-N |
| XLogP | 3.06 |
| TPSA | 158.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |