C30H27N5 — CID 57365032
2,4,6-triphenyl-5-phenyldiazenylcyclohexa-1,3-diene-1,3,5-triamine (PubChem CID 57365032) has the molecular formula C30H27N5 and a molecular weight of 457.58 g/mol. Its IUPAC name is 2,4,6-triphenyl-5-phenyldiazenylcyclohexa-1,3-diene-1,3,5-triamine.
| Compound Name | 2,4,6-triphenyl-5-phenyldiazenylcyclohexa-1,3-diene-1,3,5-triamine |
|---|---|
| PubChem CID | 57365032 |
| Molecular Formula | C30H27N5 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 2,4,6-triphenyl-5-phenyldiazenylcyclohexa-1,3-diene-1,3,5-triamine |
| SMILES | NC1=C(c2ccccc2)C(N)(/N=N/c2ccccc2)C(c2ccccc2)C(N)=C1c1ccccc1 |
| InChI | InChI=1S/C30H27N5/c31-28-25(21-13-5-1-6-14-21)29(32)27(23-17-9-3-10-18-23)30(33,26(28)22-15-7-2-8-16-22)35-34-24-19-11-4-12-20-24/h1-20,26H,31-33H2/b35-34+ |
| InChIKey | QBZKGKOOPFVMQG-XAHDOWKMSA-N |
| XLogP | 5.96 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|