About 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride
4-phenyldiazenylpyridine-2,3-diamine;hydrochloride (PubChem CID 57365046) has the molecular formula C11H12ClN5
and a molecular weight of 249.71 g/mol. Its IUPAC name is 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride |
| PubChem CID | 57365046 |
| Molecular Formula | C11H12ClN5 |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride |
| SMILES | Cl.Nc1nccc(/N=N/c2ccccc2)c1N |
| InChI | InChI=1S/C11H11N5.ClH/c12-10-9(6-7-14-11(10)13)16-15-8-4-2-1-3-5-8;/h1-7H,12H2,(H2,13,14);1H/b16-15+; |
| InChIKey | OVKRDBCQMKHMMV-GEEYTBSJSA-N |
| XLogP | 3.08 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride?
The IUPAC name of 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride (CID 57365046) is 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride.
What is the SMILES notation for 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride?
The canonical SMILES for 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride is Cl.Nc1nccc(/N=N/c2ccccc2)c1N.
What is the InChIKey of 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride?
The InChIKey is OVKRDBCQMKHMMV-GEEYTBSJSA-N. The full InChI is InChI=1S/C11H11N5.ClH/c12-10-9(6-7-14-11(10)13)16-15-8-4-2-1-3-5-8;/h1-7H,12H2,(H2,13,14);1H/b16-15+;.
What are the key properties of 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride?
4-phenyldiazenylpyridine-2,3-diamine;hydrochloride has a molecular weight of 249.71 g/mol, XLogP of 3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyldiazenylpyridine-2,3-diamine;hydrochloride is sourced from PubChem (CID 57365046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).