About N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine
N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine (PubChem CID 57365097) has the molecular formula C7H9NO2S
and a molecular weight of 171.22 g/mol. Its IUPAC name is N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 57365097 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine |
| SMILES | CNC1C=CC=CC1=S(=O)=O |
| InChI | InChI=1S/C7H9NO2S/c1-8-6-4-2-3-5-7(6)11(9)10/h2-6,8H,1H3 |
| InChIKey | DQZPZKWPVAFEFF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine?
The IUPAC name of N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine (CID 57365097) is N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine is CNC1C=CC=CC1=S(=O)=O.
What is the InChIKey of N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine?
The InChIKey is DQZPZKWPVAFEFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S/c1-8-6-4-2-3-5-7(6)11(9)10/h2-6,8H,1H3.
What are the key properties of N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine?
N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine has a molecular weight of 171.22 g/mol, XLogP of -0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-sulfonylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 57365097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).