C8H14N2O — CID 57365544
N-(3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ylidene)hydroxylamine (PubChem CID 57365544) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-(3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ylidene)hydroxylamine.
| Compound Name | N-(3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 57365544 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-(3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ylidene)hydroxylamine |
| SMILES | ON=C1CCN2CCCCC12 |
| InChI | InChI=1S/C8H14N2O/c11-9-7-4-6-10-5-2-1-3-8(7)10/h8,11H,1-6H2 |
| InChIKey | BHCNDTJIZUCUSC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|