C36H48O3Si2 — CID 57366028
13-[5-(11-oxo-13-trimethylsilyltridec-9-en-1,12-diynyl)furan-2-yl]-1-trimethylsilyltridec-4-en-1,12-diyn-3-one (PubChem CID 57366028) has the molecular formula C36H48O3Si2 and a molecular weight of 584.95 g/mol. Its IUPAC name is 13-[5-(11-oxo-13-trimethylsilyltridec-9-en-1,12-diynyl)furan-2-yl]-1-trimethylsilyltridec-4-en-1,12-diyn-3-one.
| Compound Name | 13-[5-(11-oxo-13-trimethylsilyltridec-9-en-1,12-diynyl)furan-2-yl]-1-trimethylsilyltridec-4-en-1,12-diyn-3-one |
|---|---|
| PubChem CID | 57366028 |
| Molecular Formula | C36H48O3Si2 |
| Molecular Weight | 584.95 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 13-[5-(11-oxo-13-trimethylsilyltridec-9-en-1,12-diynyl)furan-2-yl]-1-trimethylsilyltridec-4-en-1,12-diyn-3-one |
| SMILES | C[Si](C)(C)C#CC(=O)C=CCCCCCCC#Cc1ccc(C#CCCCCCCC=CC(=O)C#C[Si](C)(C)C)o1 |
| InChI | InChI=1S/C36H48O3Si2/c1-40(2,3)31-29-33(37)23-19-15-11-7-9-13-17-21-25-35-27-28-36(39-35)26-22-18-14-10-8-12-16-20-24-34(38)30-32-41(4,5)6/h19-20,23-24,27-28H,7-18H2,1-6H3 |
| InChIKey | KBKHTLZIGVQCLO-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.95 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|