About tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate
tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate (PubChem CID 57366383) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate |
| PubChem CID | 57366383 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate |
| SMILES | CC(C)c1ccc2c(c1)C(=O)CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO3/c1-11(2)12-6-7-14-13(10-12)15(19)8-9-18(14)16(20)21-17(3,4)5/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | ZEHOFPSWNUQYJN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate?
The IUPAC name of tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate (CID 57366383) is tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate.
What is the SMILES notation for tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate?
The canonical SMILES for tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate is CC(C)c1ccc2c(c1)C(=O)CCN2C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate?
The InChIKey is ZEHOFPSWNUQYJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-11(2)12-6-7-14-13(10-12)15(19)8-9-18(14)16(20)21-17(3,4)5/h6-7,10-11H,8-9H2,1-5H3.
What are the key properties of tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate?
tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate has a molecular weight of 289.38 g/mol, XLogP of 4.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-oxo-6-propan-2-yl-2,3-dihydroquinoline-1-carboxylate is sourced from PubChem (CID 57366383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).