C16H12F6O3 — CID 57366915
4-phenyl-2,6-bis(2,2,2-trifluoroacetyl)cyclohexan-1-one (PubChem CID 57366915) has the molecular formula C16H12F6O3 and a molecular weight of 366.26 g/mol. Its IUPAC name is 4-phenyl-2,6-bis(2,2,2-trifluoroacetyl)cyclohexan-1-one.
| Compound Name | 4-phenyl-2,6-bis(2,2,2-trifluoroacetyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 57366915 |
| Molecular Formula | C16H12F6O3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-phenyl-2,6-bis(2,2,2-trifluoroacetyl)cyclohexan-1-one |
| SMILES | O=C1C(C(=O)C(F)(F)F)CC(c2ccccc2)CC1C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H12F6O3/c17-15(18,19)13(24)10-6-9(8-4-2-1-3-5-8)7-11(12(10)23)14(25)16(20,21)22/h1-5,9-11H,6-7H2 |
| InChIKey | QMAKPKFQAKRYGW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|