About furo[3,2-c]pyridin-3-one;hydrochloride
furo[3,2-c]pyridin-3-one;hydrochloride (PubChem CID 57367134) has the molecular formula C7H6ClNO2
and a molecular weight of 171.58 g/mol. Its IUPAC name is furo[3,2-c]pyridin-3-one;hydrochloride.
Molecular Properties
| Compound Name | furo[3,2-c]pyridin-3-one;hydrochloride |
| PubChem CID | 57367134 |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.58 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | furo[3,2-c]pyridin-3-one;hydrochloride |
| SMILES | Cl.O=C1COc2ccncc21 |
| InChI | InChI=1S/C7H5NO2.ClH/c9-6-4-10-7-1-2-8-3-5(6)7;/h1-3H,4H2;1H |
| InChIKey | JXEJCWAWYYKGNU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.58 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furo[3,2-c]pyridin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-c]pyridin-3-one;hydrochloride?
The IUPAC name of furo[3,2-c]pyridin-3-one;hydrochloride (CID 57367134) is furo[3,2-c]pyridin-3-one;hydrochloride.
What is the SMILES notation for furo[3,2-c]pyridin-3-one;hydrochloride?
The canonical SMILES for furo[3,2-c]pyridin-3-one;hydrochloride is Cl.O=C1COc2ccncc21.
What is the InChIKey of furo[3,2-c]pyridin-3-one;hydrochloride?
The InChIKey is JXEJCWAWYYKGNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2.ClH/c9-6-4-10-7-1-2-8-3-5(6)7;/h1-3H,4H2;1H.
What are the key properties of furo[3,2-c]pyridin-3-one;hydrochloride?
furo[3,2-c]pyridin-3-one;hydrochloride has a molecular weight of 171.58 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-c]pyridin-3-one;hydrochloride is sourced from PubChem (CID 57367134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).