About 6-tribenzylstannyl-2,3-dihydroisoindol-1-one
6-tribenzylstannyl-2,3-dihydroisoindol-1-one (PubChem CID 57367188) has the molecular formula C29H27NOSn
and a molecular weight of 524.25 g/mol. Its IUPAC name is 6-tribenzylstannyl-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-tribenzylstannyl-2,3-dihydroisoindol-1-one |
| PubChem CID | 57367188 |
| Molecular Formula | C29H27NOSn |
| Molecular Weight | 524.25 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 6-tribenzylstannyl-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2ccc([Sn](Cc3ccccc3)(Cc3ccccc3)Cc3ccccc3)cc21 |
| InChI | InChI=1S/C8H6NO.3C7H7.Sn/c10-8-7-4-2-1-3-6(7)5-9-8;3*1-7-5-3-2-4-6-7;/h1,3-4H,5H2,(H,9,10);3*2-6H,1H2; |
| InChIKey | LUWOJIFSOKMMQE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.25 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tribenzylstannyl-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tribenzylstannyl-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-tribenzylstannyl-2,3-dihydroisoindol-1-one (CID 57367188) is 6-tribenzylstannyl-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-tribenzylstannyl-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-tribenzylstannyl-2,3-dihydroisoindol-1-one is O=C1NCc2ccc([Sn](Cc3ccccc3)(Cc3ccccc3)Cc3ccccc3)cc21.
What is the InChIKey of 6-tribenzylstannyl-2,3-dihydroisoindol-1-one?
The InChIKey is LUWOJIFSOKMMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6NO.3C7H7.Sn/c10-8-7-4-2-1-3-6(7)5-9-8;3*1-7-5-3-2-4-6-7;/h1,3-4H,5H2,(H,9,10);3*2-6H,1H2;.
What are the key properties of 6-tribenzylstannyl-2,3-dihydroisoindol-1-one?
6-tribenzylstannyl-2,3-dihydroisoindol-1-one has a molecular weight of 524.25 g/mol, XLogP of 4.93, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tribenzylstannyl-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 57367188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).