About 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol
3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol (PubChem CID 57368114) has the molecular formula C14H28O2Si
and a molecular weight of 256.46 g/mol. Its IUPAC name is 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol.
Molecular Properties
| Compound Name | 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol |
| PubChem CID | 57368114 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol |
| SMILES | CC(=C[C@H]1C[C@@H]1CO[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C14H28O2Si/c1-11(9-15)7-12-8-13(12)10-16-17(5,6)14(2,3)4/h7,12-13,15H,8-10H2,1-6H3/t12-,13+/m0/s1 |
| InChIKey | ZFERXFFJIFFCOS-QWHCGFSZSA-N |
| XLogP | 3.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol?
The IUPAC name of 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol (CID 57368114) is 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol.
What is the SMILES notation for 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol?
The canonical SMILES for 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol is CC(=C[C@H]1C[C@@H]1CO[Si](C)(C)C(C)(C)C)CO.
What is the InChIKey of 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol?
The InChIKey is ZFERXFFJIFFCOS-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H28O2Si/c1-11(9-15)7-12-8-13(12)10-16-17(5,6)14(2,3)4/h7,12-13,15H,8-10H2,1-6H3/t12-,13+/m0/s1.
What are the key properties of 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol?
3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol has a molecular weight of 256.46 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]-2-methylprop-2-en-1-ol is sourced from PubChem (CID 57368114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).