C26H38O2 — CID 57368387
(10S,13R,14R)-17-(furan-3-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 57368387) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is (10S,13R,14R)-17-(furan-3-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (10S,13R,14R)-17-(furan-3-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 57368387 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (10S,13R,14R)-17-(furan-3-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1(C)C(O)CC[C@]2(C)C3=C(CCC12)[C@]1(C)CCC(c2ccoc2)[C@@]1(C)CC3 |
| InChI | InChI=1S/C26H38O2/c1-23(2)21-7-6-20-19(24(21,3)12-10-22(23)27)9-14-25(4)18(8-13-26(20,25)5)17-11-15-28-16-17/h11,15-16,18,21-22,27H,6-10,12-14H2,1-5H3/t18?,21?,22?,24-,25-,26+/m1/s1 |
| InChIKey | BAOWTRLWRUVXCW-NJYOSNKWSA-N |
| XLogP | 6.86 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|