C8H9F3N2O — CID 57368453
3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-5-ol (PubChem CID 57368453) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-5-ol.
| Compound Name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-5-ol |
|---|---|
| PubChem CID | 57368453 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-5-ol |
| SMILES | OC1CCc2[nH]nc(C(F)(F)F)c2C1 |
| InChI | InChI=1S/C8H9F3N2O/c9-8(10,11)7-5-3-4(14)1-2-6(5)12-13-7/h4,14H,1-3H2,(H,12,13) |
| InChIKey | SPGXUFKNDPJPAX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |