C3H6Cl2O — CID 57369126
1,3-dichloro-1,1,2,3,3-pentadeuteriopropan-2-ol (PubChem CID 57369126) has the molecular formula C3H6Cl2O and a molecular weight of 134.02 g/mol. Its IUPAC name is 1,3-dichloro-1,1,2,3,3-pentadeuteriopropan-2-ol.
| Compound Name | 1,3-dichloro-1,1,2,3,3-pentadeuteriopropan-2-ol |
|---|---|
| PubChem CID | 57369126 |
| Molecular Formula | C3H6Cl2O |
| Molecular Weight | 134.02 g/mol |
| Exact Mass | 133.01 |
| IUPAC Name | 1,3-dichloro-1,1,2,3,3-pentadeuteriopropan-2-ol |
| SMILES | [2H]C([2H])(Cl)C([2H])(O)C([2H])([2H])Cl |
| InChI | InChI=1S/C3H6Cl2O/c4-1-3(6)2-5/h3,6H,1-2H2/i1D2,2D2,3D |
| InChIKey | DEWLEGDTCGBNGU-UXXIZXEISA-N |
| XLogP | 0.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.02 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|