C20H34ClN3O4 — CID 57369267
3-[3-acetyl-4-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]phenyl]-1,1-diethylurea;hydrochloride (PubChem CID 57369267) has the molecular formula C20H34ClN3O4 and a molecular weight of 425.02 g/mol. Its IUPAC name is 3-[3-acetyl-4-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]phenyl]-1,1-diethylurea;hydrochloride.
| Compound Name | 3-[3-acetyl-4-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]phenyl]-1,1-diethylurea;hydrochloride |
|---|---|
| PubChem CID | 57369267 |
| Molecular Formula | C20H34ClN3O4 |
| Molecular Weight | 425.02 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 3-[3-acetyl-4-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]phenyl]-1,1-diethylurea;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])C(NCC(O)COc1ccc(NC(=O)N(CC)CC)cc1C(C)=O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C20H33N3O4.ClH/c1-7-23(8-2)19(26)22-15-9-10-18(17(11-15)14(3)24)27-13-16(25)12-21-20(4,5)6;/h9-11,16,21,25H,7-8,12-13H2,1-6H3,(H,22,26);1H/i4D3,5D3,6D3; |
| InChIKey | VKJHTUVLJYWAEY-SBYXYGIXSA-N |
| XLogP | 3.31 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.02 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |