C15H21N — CID 573694
1-(1,2,3,4-tetrahydronaphthalen-2-yl)piperidine (PubChem CID 573694) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-2-yl)piperidine.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-2-yl)piperidine |
|---|---|
| PubChem CID | 573694 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-2-yl)piperidine |
| SMILES | c1ccc2c(c1)CCC(N1CCCCC1)C2 |
| InChI | InChI=1S/C15H21N/c1-4-10-16(11-5-1)15-9-8-13-6-2-3-7-14(13)12-15/h2-3,6-7,15H,1,4-5,8-12H2 |
| InChIKey | BUOJSWSFQHDDPH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |