sodium 2-methyl-3-oxobut-1-en-1-olate

C5H7NaO2 — CID 57369655

IUPACsodium 2-methyl-3-oxobut-1-en-1-olate
SMILESCC(=O)C(C)=C[O-].[Na+]
InChIInChI=1S/C5H8O2.Na/c1-4(3-6)5(2)7;/h3,6H,1-2H3;/q;+1/p-1
InChIKeyVZUJKSCAQOORQX-UHFFFAOYSA-M
MW122.10 g/mol
LogP-3.16
Rot. Bonds1

About sodium 2-methyl-3-oxobut-1-en-1-olate

sodium 2-methyl-3-oxobut-1-en-1-olate (PubChem CID 57369655) has the molecular formula C5H7NaO2 and a molecular weight of 122.10 g/mol. Its IUPAC name is sodium 2-methyl-3-oxobut-1-en-1-olate.

Molecular Properties

Compound Namesodium 2-methyl-3-oxobut-1-en-1-olate
PubChem CID57369655
Molecular FormulaC5H7NaO2
Molecular Weight122.10 g/mol
Exact Mass122.03
IUPAC Namesodium 2-methyl-3-oxobut-1-en-1-olate
SMILESCC(=O)C(C)=C[O-].[Na+]
InChIInChI=1S/C5H8O2.Na/c1-4(3-6)5(2)7;/h3,6H,1-2H3;/q;+1/p-1
InChIKeyVZUJKSCAQOORQX-UHFFFAOYSA-M
XLogP-3.16
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500122.10
LogP ≤ 5-3.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze sodium 2-methyl-3-oxobut-1-en-1-olate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-methyl-3-oxobut-1-en-1-olate?
The IUPAC name of sodium 2-methyl-3-oxobut-1-en-1-olate (CID 57369655) is sodium 2-methyl-3-oxobut-1-en-1-olate.
What is the SMILES notation for sodium 2-methyl-3-oxobut-1-en-1-olate?
The canonical SMILES for sodium 2-methyl-3-oxobut-1-en-1-olate is CC(=O)C(C)=C[O-].[Na+].
What is the InChIKey of sodium 2-methyl-3-oxobut-1-en-1-olate?
The InChIKey is VZUJKSCAQOORQX-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O2.Na/c1-4(3-6)5(2)7;/h3,6H,1-2H3;/q;+1/p-1.
What are the key properties of sodium 2-methyl-3-oxobut-1-en-1-olate?
sodium 2-methyl-3-oxobut-1-en-1-olate has a molecular weight of 122.10 g/mol, XLogP of -3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methyl-3-oxobut-1-en-1-olate is sourced from PubChem (CID 57369655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).