C10HF22N — CID 57369719
1,1,2,2,3,3,4,4,4-nonafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-N-(1,1,2,2-tetrafluoroethyl)butan-1-amine (PubChem CID 57369719) has the molecular formula C10HF22N and a molecular weight of 553.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-N-(1,1,2,2-tetrafluoroethyl)butan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-N-(1,1,2,2-tetrafluoroethyl)butan-1-amine |
|---|---|
| PubChem CID | 57369719 |
| Molecular Formula | C10HF22N |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-N-(1,1,2,2-tetrafluoroethyl)butan-1-amine |
| SMILES | FC(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10HF22N/c11-1(12)2(13,14)33(9(29,30)5(19,20)3(15,16)7(23,24)25)10(31,32)6(21,22)4(17,18)8(26,27)28/h1H |
| InChIKey | XIZJNXITWZVXFR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|