About methyl carbonate;1-methyl-3-propylimidazol-1-ium
methyl carbonate;1-methyl-3-propylimidazol-1-ium (PubChem CID 57369984) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is methyl carbonate;1-methyl-3-propylimidazol-1-ium.
Molecular Properties
| Compound Name | methyl carbonate;1-methyl-3-propylimidazol-1-ium |
| PubChem CID | 57369984 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | methyl carbonate;1-methyl-3-propylimidazol-1-ium |
| SMILES | CCCn1cc[n+](C)c1.COC(=O)[O-] |
| InChI | InChI=1S/C7H13N2.C2H4O3/c1-3-4-9-6-5-8(2)7-9;1-5-2(3)4/h5-7H,3-4H2,1-2H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | ABSPGMJUOBVQMZ-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl carbonate;1-methyl-3-propylimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl carbonate;1-methyl-3-propylimidazol-1-ium?
The IUPAC name of methyl carbonate;1-methyl-3-propylimidazol-1-ium (CID 57369984) is methyl carbonate;1-methyl-3-propylimidazol-1-ium.
What is the SMILES notation for methyl carbonate;1-methyl-3-propylimidazol-1-ium?
The canonical SMILES for methyl carbonate;1-methyl-3-propylimidazol-1-ium is CCCn1cc[n+](C)c1.COC(=O)[O-].
What is the InChIKey of methyl carbonate;1-methyl-3-propylimidazol-1-ium?
The InChIKey is ABSPGMJUOBVQMZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13N2.C2H4O3/c1-3-4-9-6-5-8(2)7-9;1-5-2(3)4/h5-7H,3-4H2,1-2H3;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of methyl carbonate;1-methyl-3-propylimidazol-1-ium?
methyl carbonate;1-methyl-3-propylimidazol-1-ium has a molecular weight of 200.24 g/mol, XLogP of -0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl carbonate;1-methyl-3-propylimidazol-1-ium is sourced from PubChem (CID 57369984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).