About 2-(3,4-diaminophenyl)ethanol
2-(3,4-diaminophenyl)ethanol (PubChem CID 57370219) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-(3,4-diaminophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(3,4-diaminophenyl)ethanol |
| PubChem CID | 57370219 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-(3,4-diaminophenyl)ethanol |
| SMILES | Nc1ccc(CCO)cc1N |
| InChI | InChI=1S/C8H12N2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4,9-10H2 |
| InChIKey | JBRDLNMAUMZCPN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-diaminophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-diaminophenyl)ethanol?
The IUPAC name of 2-(3,4-diaminophenyl)ethanol (CID 57370219) is 2-(3,4-diaminophenyl)ethanol.
What is the SMILES notation for 2-(3,4-diaminophenyl)ethanol?
The canonical SMILES for 2-(3,4-diaminophenyl)ethanol is Nc1ccc(CCO)cc1N.
What is the InChIKey of 2-(3,4-diaminophenyl)ethanol?
The InChIKey is JBRDLNMAUMZCPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4,9-10H2.
What are the key properties of 2-(3,4-diaminophenyl)ethanol?
2-(3,4-diaminophenyl)ethanol has a molecular weight of 152.20 g/mol, XLogP of 0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-diaminophenyl)ethanol is sourced from PubChem (CID 57370219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).