C9H19O11P — CID 57370438
[(2S,3R,5S,6S)-1-(2,3-dihydroxypropyl)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate (PubChem CID 57370438) has the molecular formula C9H19O11P and a molecular weight of 334.21 g/mol. Its IUPAC name is [(2S,3R,5S,6S)-1-(2,3-dihydroxypropyl)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(2S,3R,5S,6S)-1-(2,3-dihydroxypropyl)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 57370438 |
| Molecular Formula | C9H19O11P |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [(2S,3R,5S,6S)-1-(2,3-dihydroxypropyl)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1(CC(O)CO)[C@@H](O)[C@H](O)C(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H19O11P/c10-2-3(11)1-9(20-21(17,18)19)7(15)5(13)4(12)6(14)8(9)16/h3-8,10-16H,1-2H2,(H2,17,18,19)/t3?,4?,5-,6+,7-,8-,9?/m0/s1 |
| InChIKey | RSUBPDSBRWYXPO-LIPDPKNMSA-N |
| XLogP | -4.60 |
| TPSA | 208.37 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|