C33H57NO6 — CID 57370546
[3-[benzyl-[3-(2,2-dimethyloctanoyloxy)-2-hydroxypropyl]amino]-2-hydroxypropyl] 2,2-dimethyloctanoate (PubChem CID 57370546) has the molecular formula C33H57NO6 and a molecular weight of 563.82 g/mol. Its IUPAC name is [3-[benzyl-[3-(2,2-dimethyloctanoyloxy)-2-hydroxypropyl]amino]-2-hydroxypropyl] 2,2-dimethyloctanoate.
| Compound Name | [3-[benzyl-[3-(2,2-dimethyloctanoyloxy)-2-hydroxypropyl]amino]-2-hydroxypropyl] 2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 57370546 |
| Molecular Formula | C33H57NO6 |
| Molecular Weight | 563.82 g/mol |
| Exact Mass | 563.42 |
| IUPAC Name | [3-[benzyl-[3-(2,2-dimethyloctanoyloxy)-2-hydroxypropyl]amino]-2-hydroxypropyl] 2,2-dimethyloctanoate |
| SMILES | CCCCCCC(C)(C)C(=O)OCC(O)CN(Cc1ccccc1)CC(O)COC(=O)C(C)(C)CCCCCC |
| InChI | InChI=1S/C33H57NO6/c1-7-9-11-16-20-32(3,4)30(37)39-25-28(35)23-34(22-27-18-14-13-15-19-27)24-29(36)26-40-31(38)33(5,6)21-17-12-10-8-2/h13-15,18-19,28-29,35-36H,7-12,16-17,20-26H2,1-6H3 |
| InChIKey | XIGOSJBUBGZVSV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.82 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|