C16H12O4S3 — CID 57370586
5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 57370586) has the molecular formula C16H12O4S3 and a molecular weight of 364.47 g/mol. Its IUPAC name is 5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 57370586 |
| Molecular Formula | C16H12O4S3 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 5-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | c1cc(-c2scc3c2OCCO3)sc1-c1scc2c1OCCO2 |
| InChI | InChI=1S/C16H12O4S3/c1-2-12(16-14-10(8-22-16)18-4-6-20-14)23-11(1)15-13-9(7-21-15)17-3-5-19-13/h1-2,7-8H,3-6H2 |
| InChIKey | XLLUGGFGFHVJBV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |