About 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide
1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide (PubChem CID 57370684) has the molecular formula C10H21IN2
and a molecular weight of 296.20 g/mol. Its IUPAC name is 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide.
Molecular Properties
| Compound Name | 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide |
| PubChem CID | 57370684 |
| Molecular Formula | C10H21IN2 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide |
| SMILES | CCCCCC[NH+]1C=CN(C)C1.[I-] |
| InChI | InChI=1S/C10H20N2.HI/c1-3-4-5-6-7-12-9-8-11(2)10-12;/h8-9H,3-7,10H2,1-2H3;1H |
| InChIKey | BZOWMAXZYKBNPP-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide?
The IUPAC name of 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide (CID 57370684) is 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide.
What is the SMILES notation for 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide?
The canonical SMILES for 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide is CCCCCC[NH+]1C=CN(C)C1.[I-].
What is the InChIKey of 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide?
The InChIKey is BZOWMAXZYKBNPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.HI/c1-3-4-5-6-7-12-9-8-11(2)10-12;/h8-9H,3-7,10H2,1-2H3;1H.
What are the key properties of 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide?
1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide has a molecular weight of 296.20 g/mol, XLogP of -2.17, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-3-methyl-1,2-dihydroimidazol-1-ium iodide is sourced from PubChem (CID 57370684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).