About cyclohexylazanium;sulfate
cyclohexylazanium;sulfate (PubChem CID 57370707) has the molecular formula C12H28N2O4S
and a molecular weight of 296.43 g/mol. Its IUPAC name is cyclohexylazanium;sulfate.
Molecular Properties
| Compound Name | cyclohexylazanium;sulfate |
| PubChem CID | 57370707 |
| Molecular Formula | C12H28N2O4S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | cyclohexylazanium;sulfate |
| SMILES | O=S(=O)([O-])[O-].[NH3+]C1CCCCC1.[NH3+]C1CCCCC1 |
| InChI | InChI=1S/2C6H13N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*6H,1-5,7H2;(H2,1,2,3,4) |
| InChIKey | WZBMSCFCEJIJSE-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylazanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylazanium;sulfate?
The IUPAC name of cyclohexylazanium;sulfate (CID 57370707) is cyclohexylazanium;sulfate.
What is the SMILES notation for cyclohexylazanium;sulfate?
The canonical SMILES for cyclohexylazanium;sulfate is O=S(=O)([O-])[O-].[NH3+]C1CCCCC1.[NH3+]C1CCCCC1.
What is the InChIKey of cyclohexylazanium;sulfate?
The InChIKey is WZBMSCFCEJIJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*6H,1-5,7H2;(H2,1,2,3,4).
What are the key properties of cyclohexylazanium;sulfate?
cyclohexylazanium;sulfate has a molecular weight of 296.43 g/mol, XLogP of -0.22, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylazanium;sulfate is sourced from PubChem (CID 57370707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).