C9H7N3 — CID 57370721
5,6,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene (PubChem CID 57370721) has the molecular formula C9H7N3 and a molecular weight of 157.18 g/mol. Its IUPAC name is 5,6,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene.
| Compound Name | 5,6,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
|---|---|
| PubChem CID | 57370721 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 5,6,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaene |
| SMILES | c1cc2c3ccnn3ccn2c1 |
| InChI | InChI=1S/C9H7N3/c1-2-8-9-3-4-10-12(9)7-6-11(8)5-1/h1-7H |
| InChIKey | XKKBUOVBKHZJNZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 21.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |