C15H23O3- — CID 57371389
2-(3-hydroxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)propanoate (PubChem CID 57371389) has the molecular formula C15H23O3- and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-(3-hydroxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)propanoate.
| Compound Name | 2-(3-hydroxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 57371389 |
| Molecular Formula | C15H23O3- |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-(3-hydroxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)propanoate |
| SMILES | CC1=C2CC(C(C)C(=O)[O-])C(O)CC2(C)CCC1 |
| InChI | InChI=1S/C15H24O3/c1-9-5-4-6-15(3)8-13(16)11(7-12(9)15)10(2)14(17)18/h10-11,13,16H,4-8H2,1-3H3,(H,17,18)/p-1 |
| InChIKey | BPABKEXKTPSVHO-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|