About 2-(5-phenyl-1,3-oxazol-2-yl)propanoate
2-(5-phenyl-1,3-oxazol-2-yl)propanoate (PubChem CID 57371463) has the molecular formula C12H10NO3-
and a molecular weight of 216.22 g/mol. Its IUPAC name is 2-(5-phenyl-1,3-oxazol-2-yl)propanoate.
Molecular Properties
| Compound Name | 2-(5-phenyl-1,3-oxazol-2-yl)propanoate |
| PubChem CID | 57371463 |
| Molecular Formula | C12H10NO3- |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-(5-phenyl-1,3-oxazol-2-yl)propanoate |
| SMILES | CC(C(=O)[O-])c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H11NO3/c1-8(12(14)15)11-13-7-10(16-11)9-5-3-2-4-6-9/h2-8H,1H3,(H,14,15)/p-1 |
| InChIKey | PCFZKBOVQGQJDZ-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-phenyl-1,3-oxazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-phenyl-1,3-oxazol-2-yl)propanoate?
The IUPAC name of 2-(5-phenyl-1,3-oxazol-2-yl)propanoate (CID 57371463) is 2-(5-phenyl-1,3-oxazol-2-yl)propanoate.
What is the SMILES notation for 2-(5-phenyl-1,3-oxazol-2-yl)propanoate?
The canonical SMILES for 2-(5-phenyl-1,3-oxazol-2-yl)propanoate is CC(C(=O)[O-])c1ncc(-c2ccccc2)o1.
What is the InChIKey of 2-(5-phenyl-1,3-oxazol-2-yl)propanoate?
The InChIKey is PCFZKBOVQGQJDZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H11NO3/c1-8(12(14)15)11-13-7-10(16-11)9-5-3-2-4-6-9/h2-8H,1H3,(H,14,15)/p-1.
What are the key properties of 2-(5-phenyl-1,3-oxazol-2-yl)propanoate?
2-(5-phenyl-1,3-oxazol-2-yl)propanoate has a molecular weight of 216.22 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-phenyl-1,3-oxazol-2-yl)propanoate is sourced from PubChem (CID 57371463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).