About (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid
(4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid (PubChem CID 57371806) has the molecular formula C8H8ClN5O2
and a molecular weight of 241.64 g/mol. Its IUPAC name is (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid.
Molecular Properties
| Compound Name | (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid |
| PubChem CID | 57371806 |
| Molecular Formula | C8H8ClN5O2 |
| Molecular Weight | 241.64 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid |
| SMILES | CCN(C(=O)O)c1cc2n[nH]nc2c(Cl)n1 |
| InChI | InChI=1S/C8H8ClN5O2/c1-2-14(8(15)16)5-3-4-6(7(9)10-5)12-13-11-4/h3H,2H2,1H3,(H,15,16)(H,11,12,13) |
| InChIKey | UIIIWYGCHJBGSJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.64 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid?
The IUPAC name of (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid (CID 57371806) is (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid.
What is the SMILES notation for (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid?
The canonical SMILES for (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid is CCN(C(=O)O)c1cc2n[nH]nc2c(Cl)n1.
What is the InChIKey of (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid?
The InChIKey is UIIIWYGCHJBGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN5O2/c1-2-14(8(15)16)5-3-4-6(7(9)10-5)12-13-11-4/h3H,2H2,1H3,(H,15,16)(H,11,12,13).
What are the key properties of (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid?
(4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid has a molecular weight of 241.64 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2H-triazolo[4,5-c]pyridin-6-yl)-ethylcarbamic acid is sourced from PubChem (CID 57371806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).