About zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride
zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride (PubChem CID 57372146) has the molecular formula C8H8ClFZn
and a molecular weight of 223.99 g/mol. Its IUPAC name is zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride.
Molecular Properties
| Compound Name | zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride |
| PubChem CID | 57372146 |
| Molecular Formula | C8H8ClFZn |
| Molecular Weight | 223.99 g/mol |
| Exact Mass | 221.96 |
| IUPAC Name | zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride |
| SMILES | [CH2-]c1cccc(F)c1C.[Cl-].[Zn+2] |
| InChI | InChI=1S/C8H8F.ClH.Zn/c1-6-4-3-5-8(9)7(6)2;;/h3-5H,1H2,2H3;1H;/q-1;;+2/p-1 |
| InChIKey | GIMREOLKLNZNMG-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.99 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride?
The IUPAC name of zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride (CID 57372146) is zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride.
What is the SMILES notation for zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride?
The canonical SMILES for zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride is [CH2-]c1cccc(F)c1C.[Cl-].[Zn+2].
What is the InChIKey of zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride?
The InChIKey is GIMREOLKLNZNMG-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8F.ClH.Zn/c1-6-4-3-5-8(9)7(6)2;;/h3-5H,1H2,2H3;1H;/q-1;;+2/p-1.
What are the key properties of zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride?
zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride has a molecular weight of 223.99 g/mol, XLogP of -0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;1-fluoro-3-methanidyl-2-methylbenzene;chloride is sourced from PubChem (CID 57372146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).