C14H12Br2N2 — CID 57372244
N-[(2,5-dibromo-4-methylphenyl)methylideneamino]aniline (PubChem CID 57372244) has the molecular formula C14H12Br2N2 and a molecular weight of 368.07 g/mol. Its IUPAC name is N-[(2,5-dibromo-4-methylphenyl)methylideneamino]aniline.
| Compound Name | N-[(2,5-dibromo-4-methylphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 57372244 |
| Molecular Formula | C14H12Br2N2 |
| Molecular Weight | 368.07 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | N-[(2,5-dibromo-4-methylphenyl)methylideneamino]aniline |
| SMILES | Cc1cc(Br)c(C=NNc2ccccc2)cc1Br |
| InChI | InChI=1S/C14H12Br2N2/c1-10-7-14(16)11(8-13(10)15)9-17-18-12-5-3-2-4-6-12/h2-9,18H,1H3 |
| InChIKey | PBBUGVVQGONNLY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.07 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|