C12H4BrF5O3S — CID 57372260
4-bromo-2-(2,3,4,5,6-pentafluorophenyl)benzenesulfonic acid (PubChem CID 57372260) has the molecular formula C12H4BrF5O3S and a molecular weight of 403.12 g/mol. Its IUPAC name is 4-bromo-2-(2,3,4,5,6-pentafluorophenyl)benzenesulfonic acid.
| Compound Name | 4-bromo-2-(2,3,4,5,6-pentafluorophenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 57372260 |
| Molecular Formula | C12H4BrF5O3S |
| Molecular Weight | 403.12 g/mol |
| Exact Mass | 401.90 |
| IUPAC Name | 4-bromo-2-(2,3,4,5,6-pentafluorophenyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Br)cc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H4BrF5O3S/c13-4-1-2-6(22(19,20)21)5(3-4)7-8(14)10(16)12(18)11(17)9(7)15/h1-3H,(H,19,20,21) |
| InChIKey | WQTLFYWHCKWBOE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.12 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|