C27H56O2Si3 — CID 57372727
3-[(1R,2S,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenylcyclopentyl]prop-2-enyl-trimethylsilane (PubChem CID 57372727) has the molecular formula C27H56O2Si3 and a molecular weight of 497.00 g/mol. Its IUPAC name is 3-[(1R,2S,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenylcyclopentyl]prop-2-enyl-trimethylsilane.
| Compound Name | 3-[(1R,2S,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenylcyclopentyl]prop-2-enyl-trimethylsilane |
|---|---|
| PubChem CID | 57372727 |
| Molecular Formula | C27H56O2Si3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | 3-[(1R,2S,3R,4S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenylcyclopentyl]prop-2-enyl-trimethylsilane |
| SMILES | C=C[C@@H]1C[C@H](C=CC[Si](C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O2Si3/c1-15-22-19-23(17-16-18-30(8,9)10)25(21-29-32(13,14)27(5,6)7)24(22)20-28-31(11,12)26(2,3)4/h15-17,22-25H,1,18-21H2,2-14H3/t22-,23+,24-,25+/m1/s1 |
| InChIKey | CORFZJCKZHLHPD-RCTAOEEJSA-N |
| XLogP | 8.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|