About cobalt;cyclooctane;cyclooctyl(trimethyl)silane
cobalt;cyclooctane;cyclooctyl(trimethyl)silane (PubChem CID 57373058) has the molecular formula C19H40CoSi
and a molecular weight of 355.55 g/mol. Its IUPAC name is cobalt;cyclooctane;cyclooctyl(trimethyl)silane.
Molecular Properties
| Compound Name | cobalt;cyclooctane;cyclooctyl(trimethyl)silane |
| PubChem CID | 57373058 |
| Molecular Formula | C19H40CoSi |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | cobalt;cyclooctane;cyclooctyl(trimethyl)silane |
| SMILES | C1CCCCCCC1.C[Si](C)(C)C1CCCCCCC1.[Co] |
| InChI | InChI=1S/C11H24Si.C8H16.Co/c1-12(2,3)11-9-7-5-4-6-8-10-11;1-2-4-6-8-7-5-3-1;/h11H,4-10H2,1-3H3;1-8H2; |
| InChIKey | HMWILWRPTJRMGC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cobalt;cyclooctane;cyclooctyl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;cyclooctane;cyclooctyl(trimethyl)silane?
The IUPAC name of cobalt;cyclooctane;cyclooctyl(trimethyl)silane (CID 57373058) is cobalt;cyclooctane;cyclooctyl(trimethyl)silane.
What is the SMILES notation for cobalt;cyclooctane;cyclooctyl(trimethyl)silane?
The canonical SMILES for cobalt;cyclooctane;cyclooctyl(trimethyl)silane is C1CCCCCCC1.C[Si](C)(C)C1CCCCCCC1.[Co].
What is the InChIKey of cobalt;cyclooctane;cyclooctyl(trimethyl)silane?
The InChIKey is HMWILWRPTJRMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24Si.C8H16.Co/c1-12(2,3)11-9-7-5-4-6-8-10-11;1-2-4-6-8-7-5-3-1;/h11H,4-10H2,1-3H3;1-8H2;.
What are the key properties of cobalt;cyclooctane;cyclooctyl(trimethyl)silane?
cobalt;cyclooctane;cyclooctyl(trimethyl)silane has a molecular weight of 355.55 g/mol, XLogP of 7.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;cyclooctane;cyclooctyl(trimethyl)silane is sourced from PubChem (CID 57373058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).