C14H12O4 — CID 57373263
1-(5-acetyl-3,6-dihydroxynaphthalen-2-yl)ethanone (PubChem CID 57373263) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1-(5-acetyl-3,6-dihydroxynaphthalen-2-yl)ethanone.
| Compound Name | 1-(5-acetyl-3,6-dihydroxynaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 57373263 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(5-acetyl-3,6-dihydroxynaphthalen-2-yl)ethanone |
| SMILES | CC(=O)c1cc2ccc(O)c(C(C)=O)c2cc1O |
| InChI | InChI=1S/C14H12O4/c1-7(15)10-5-9-3-4-12(17)14(8(2)16)11(9)6-13(10)18/h3-6,17-18H,1-2H3 |
| InChIKey | SAQJAHCYYSYVJA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |