C27H34O7 — CID 57373517
[(8S,9S,10S,13S,14S)-17-(4-acetyloxy-5-oxofuran-2-ylidene)-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 57373517) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S)-17-(4-acetyloxy-5-oxofuran-2-ylidene)-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9S,10S,13S,14S)-17-(4-acetyloxy-5-oxofuran-2-ylidene)-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 57373517 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | [(8S,9S,10S,13S,14S)-17-(4-acetyloxy-5-oxofuran-2-ylidene)-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1=CC(=C2CC[C@H]3[C@@H]4CCC5CC(OC(C)=O)CC[C@]5(C)[C@H]4C(=O)C[C@]23C)OC1=O |
| InChI | InChI=1S/C27H34O7/c1-14(28)32-17-9-10-26(3)16(11-17)5-6-18-19-7-8-20(27(19,4)13-21(30)24(18)26)22-12-23(25(31)34-22)33-15(2)29/h12,16-19,24H,5-11,13H2,1-4H3/t16?,17?,18-,19-,24+,26-,27-/m0/s1 |
| InChIKey | BUZHZADIDOSEQS-YLUMPLOKSA-N |
| XLogP | 4.40 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|