C10H18N3O3- — CID 57374023
4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazine-1-carboxylate (PubChem CID 57374023) has the molecular formula C10H18N3O3- and a molecular weight of 228.27 g/mol. Its IUPAC name is 4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazine-1-carboxylate.
| Compound Name | 4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57374023 |
| Molecular Formula | C10H18N3O3- |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)NC(=O)CN1CCN(C(=O)[O-])CC1 |
| InChI | InChI=1S/C10H19N3O3/c1-8(2)11-9(14)7-12-3-5-13(6-4-12)10(15)16/h8H,3-7H2,1-2H3,(H,11,14)(H,15,16)/p-1 |
| InChIKey | CEBKSMLHERKBRS-UHFFFAOYSA-M |
| XLogP | -1.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |