C15H21Cl9Si3 — CID 57374289
trichloro-[2-[2,4,6-trimethyl-3,5-bis(2-trichlorosilylethyl)phenyl]ethyl]silane (PubChem CID 57374289) has the molecular formula C15H21Cl9Si3 and a molecular weight of 604.67 g/mol. Its IUPAC name is trichloro-[2-[2,4,6-trimethyl-3,5-bis(2-trichlorosilylethyl)phenyl]ethyl]silane.
| Compound Name | trichloro-[2-[2,4,6-trimethyl-3,5-bis(2-trichlorosilylethyl)phenyl]ethyl]silane |
|---|---|
| PubChem CID | 57374289 |
| Molecular Formula | C15H21Cl9Si3 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 599.81 |
| IUPAC Name | trichloro-[2-[2,4,6-trimethyl-3,5-bis(2-trichlorosilylethyl)phenyl]ethyl]silane |
| SMILES | Cc1c(CC[Si](Cl)(Cl)Cl)c(C)c(CC[Si](Cl)(Cl)Cl)c(C)c1CC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C15H21Cl9Si3/c1-10-13(4-7-25(16,17)18)11(2)15(6-9-27(22,23)24)12(3)14(10)5-8-26(19,20)21/h4-9H2,1-3H3 |
| InChIKey | DHYVUHLZJNMXTN-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|