About 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate (PubChem CID 57374380) has the molecular formula C18H27N2O2S-
and a molecular weight of 335.49 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate |
| PubChem CID | 57374380 |
| Molecular Formula | C18H27N2O2S- |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate |
| SMILES | Cc1cc(C)nc(SC(C(=O)[O-])C2CC(C)CCC2C(C)C)n1 |
| InChI | InChI=1S/C18H28N2O2S/c1-10(2)14-7-6-11(3)8-15(14)16(17(21)22)23-18-19-12(4)9-13(5)20-18/h9-11,14-16H,6-8H2,1-5H3,(H,21,22)/p-1 |
| InChIKey | ZMXKFBUNLNCLCL-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate (CID 57374380) is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate is Cc1cc(C)nc(SC(C(=O)[O-])C2CC(C)CCC2C(C)C)n1.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate?
The InChIKey is ZMXKFBUNLNCLCL-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H28N2O2S/c1-10(2)14-7-6-11(3)8-15(14)16(17(21)22)23-18-19-12(4)9-13(5)20-18/h9-11,14-16H,6-8H2,1-5H3,(H,21,22)/p-1.
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate?
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate has a molecular weight of 335.49 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(5-methyl-2-propan-2-ylcyclohexyl)acetate is sourced from PubChem (CID 57374380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).