C20H17O4- — CID 57374963
2-(5-oxo-2,3-diphenylfuran-2-yl)butanoate (PubChem CID 57374963) has the molecular formula C20H17O4- and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-(5-oxo-2,3-diphenylfuran-2-yl)butanoate.
| Compound Name | 2-(5-oxo-2,3-diphenylfuran-2-yl)butanoate |
|---|---|
| PubChem CID | 57374963 |
| Molecular Formula | C20H17O4- |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(5-oxo-2,3-diphenylfuran-2-yl)butanoate |
| SMILES | CCC(C(=O)[O-])C1(c2ccccc2)OC(=O)C=C1c1ccccc1 |
| InChI | InChI=1S/C20H18O4/c1-2-16(19(22)23)20(15-11-7-4-8-12-15)17(13-18(21)24-20)14-9-5-3-6-10-14/h3-13,16H,2H2,1H3,(H,22,23)/p-1 |
| InChIKey | HOOHWOBSFFBALF-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |